C12H8Br2Cl2O — CID 63530606
2-bromo-5-[1-bromo-2-(3,4-dichlorophenyl)ethyl]furan (PubChem CID 63530606) has the molecular formula C12H8Br2Cl2O and a molecular weight of 398.91 g/mol. Its IUPAC name is 2-bromo-5-[1-bromo-2-(3,4-dichlorophenyl)ethyl]furan.
| Compound Name | 2-bromo-5-[1-bromo-2-(3,4-dichlorophenyl)ethyl]furan |
|---|---|
| PubChem CID | 63530606 |
| Molecular Formula | C12H8Br2Cl2O |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 395.83 |
| IUPAC Name | 2-bromo-5-[1-bromo-2-(3,4-dichlorophenyl)ethyl]furan |
| SMILES | Clc1ccc(CC(Br)c2ccc(Br)o2)cc1Cl |
| InChI | InChI=1S/C12H8Br2Cl2O/c13-8(11-3-4-12(14)17-11)5-7-1-2-9(15)10(16)6-7/h1-4,6,8H,5H2 |
| InChIKey | TYZOXLWDHKRYOQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|