C14H14BrClO — CID 106689774
2-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-5-chlorofuran (PubChem CID 106689774) has the molecular formula C14H14BrClO and a molecular weight of 313.62 g/mol. Its IUPAC name is 2-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-5-chlorofuran.
| Compound Name | 2-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-5-chlorofuran |
|---|---|
| PubChem CID | 106689774 |
| Molecular Formula | C14H14BrClO |
| Molecular Weight | 313.62 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 2-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-5-chlorofuran |
| SMILES | Cc1ccc(CC(Br)c2ccc(Cl)o2)cc1C |
| InChI | InChI=1S/C14H14BrClO/c1-9-3-4-11(7-10(9)2)8-12(15)13-5-6-14(16)17-13/h3-7,12H,8H2,1-2H3 |
| InChIKey | BRUJWHRWIUXUTG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|