C17H18BrClO — CID 63542728
1-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-4-chloro-2-methoxybenzene (PubChem CID 63542728) has the molecular formula C17H18BrClO and a molecular weight of 353.69 g/mol. Its IUPAC name is 1-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-4-chloro-2-methoxybenzene.
| Compound Name | 1-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-4-chloro-2-methoxybenzene |
|---|---|
| PubChem CID | 63542728 |
| Molecular Formula | C17H18BrClO |
| Molecular Weight | 353.69 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 1-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-4-chloro-2-methoxybenzene |
| SMILES | COc1cc(Cl)ccc1C(Br)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H18BrClO/c1-11-4-5-13(8-12(11)2)9-16(18)15-7-6-14(19)10-17(15)20-3/h4-8,10,16H,9H2,1-3H3 |
| InChIKey | YQIUYOUUDNNJIT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|