C17H19ClO2 — CID 63018032
1-(4-chloro-2-methoxyphenyl)-2-(3,4-dimethylphenyl)ethanol (PubChem CID 63018032) has the molecular formula C17H19ClO2 and a molecular weight of 290.79 g/mol. Its IUPAC name is 1-(4-chloro-2-methoxyphenyl)-2-(3,4-dimethylphenyl)ethanol.
| Compound Name | 1-(4-chloro-2-methoxyphenyl)-2-(3,4-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 63018032 |
| Molecular Formula | C17H19ClO2 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-(4-chloro-2-methoxyphenyl)-2-(3,4-dimethylphenyl)ethanol |
| SMILES | COc1cc(Cl)ccc1C(O)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H19ClO2/c1-11-4-5-13(8-12(11)2)9-16(19)15-7-6-14(18)10-17(15)20-3/h4-8,10,16,19H,9H2,1-3H3 |
| InChIKey | JWWLJAVGZSSMCZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |