C13H10BrF2N — CID 66454388
2-[2-bromo-2-(3,4-difluorophenyl)ethyl]pyridine (PubChem CID 66454388) has the molecular formula C13H10BrF2N and a molecular weight of 298.13 g/mol. Its IUPAC name is 2-[2-bromo-2-(3,4-difluorophenyl)ethyl]pyridine.
| Compound Name | 2-[2-bromo-2-(3,4-difluorophenyl)ethyl]pyridine |
|---|---|
| PubChem CID | 66454388 |
| Molecular Formula | C13H10BrF2N |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 2-[2-bromo-2-(3,4-difluorophenyl)ethyl]pyridine |
| SMILES | Fc1ccc(C(Br)Cc2ccccn2)cc1F |
| InChI | InChI=1S/C13H10BrF2N/c14-11(8-10-3-1-2-6-17-10)9-4-5-12(15)13(16)7-9/h1-7,11H,8H2 |
| InChIKey | UERLZVCVYQBSCE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|