C13H10Br3N — CID 107958138
2-[2-bromo-2-(2,4-dibromophenyl)ethyl]pyridine (PubChem CID 107958138) has the molecular formula C13H10Br3N and a molecular weight of 419.94 g/mol. Its IUPAC name is 2-[2-bromo-2-(2,4-dibromophenyl)ethyl]pyridine.
| Compound Name | 2-[2-bromo-2-(2,4-dibromophenyl)ethyl]pyridine |
|---|---|
| PubChem CID | 107958138 |
| Molecular Formula | C13H10Br3N |
| Molecular Weight | 419.94 g/mol |
| Exact Mass | 416.84 |
| IUPAC Name | 2-[2-bromo-2-(2,4-dibromophenyl)ethyl]pyridine |
| SMILES | Brc1ccc(C(Br)Cc2ccccn2)c(Br)c1 |
| InChI | InChI=1S/C13H10Br3N/c14-9-4-5-11(12(15)7-9)13(16)8-10-3-1-2-6-17-10/h1-7,13H,8H2 |
| InChIKey | SHMITUGLZLZVOM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.94 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|