C14H9Br3F2 — CID 107958068
2,4-dibromo-1-[1-bromo-2-(2,6-difluorophenyl)ethyl]benzene (PubChem CID 107958068) has the molecular formula C14H9Br3F2 and a molecular weight of 454.93 g/mol. Its IUPAC name is 2,4-dibromo-1-[1-bromo-2-(2,6-difluorophenyl)ethyl]benzene.
| Compound Name | 2,4-dibromo-1-[1-bromo-2-(2,6-difluorophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 107958068 |
| Molecular Formula | C14H9Br3F2 |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 451.82 |
| IUPAC Name | 2,4-dibromo-1-[1-bromo-2-(2,6-difluorophenyl)ethyl]benzene |
| SMILES | Fc1cccc(F)c1CC(Br)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H9Br3F2/c15-8-4-5-9(11(16)6-8)12(17)7-10-13(18)2-1-3-14(10)19/h1-6,12H,7H2 |
| InChIKey | QUCHTADRADQIQR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|