C12H7Br2ClF2S — CID 102836863
3-bromo-5-[1-bromo-2-(2,6-difluorophenyl)ethyl]-2-chlorothiophene (PubChem CID 102836863) has the molecular formula C12H7Br2ClF2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 3-bromo-5-[1-bromo-2-(2,6-difluorophenyl)ethyl]-2-chlorothiophene.
| Compound Name | 3-bromo-5-[1-bromo-2-(2,6-difluorophenyl)ethyl]-2-chlorothiophene |
|---|---|
| PubChem CID | 102836863 |
| Molecular Formula | C12H7Br2ClF2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 413.83 |
| IUPAC Name | 3-bromo-5-[1-bromo-2-(2,6-difluorophenyl)ethyl]-2-chlorothiophene |
| SMILES | Fc1cccc(F)c1CC(Br)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C12H7Br2ClF2S/c13-7(11-5-8(14)12(15)18-11)4-6-9(16)2-1-3-10(6)17/h1-3,5,7H,4H2 |
| InChIKey | PCJLBNGUBZLUOW-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|