C14H9Br2F2I — CID 114026478
1-bromo-2-[1-bromo-2-(2,6-difluorophenyl)ethyl]-4-iodobenzene (PubChem CID 114026478) has the molecular formula C14H9Br2F2I and a molecular weight of 501.93 g/mol. Its IUPAC name is 1-bromo-2-[1-bromo-2-(2,6-difluorophenyl)ethyl]-4-iodobenzene.
| Compound Name | 1-bromo-2-[1-bromo-2-(2,6-difluorophenyl)ethyl]-4-iodobenzene |
|---|---|
| PubChem CID | 114026478 |
| Molecular Formula | C14H9Br2F2I |
| Molecular Weight | 501.93 g/mol |
| Exact Mass | 499.81 |
| IUPAC Name | 1-bromo-2-[1-bromo-2-(2,6-difluorophenyl)ethyl]-4-iodobenzene |
| SMILES | Fc1cccc(F)c1CC(Br)c1cc(I)ccc1Br |
| InChI | InChI=1S/C14H9Br2F2I/c15-11-5-4-8(19)6-9(11)12(16)7-10-13(17)2-1-3-14(10)18/h1-6,12H,7H2 |
| InChIKey | DJTUGQUPYBGHBH-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.93 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|