C13H6Br2ClF2I — CID 114026323
1-[bromo-(2-bromo-5-iodophenyl)methyl]-2-chloro-4,5-difluorobenzene (PubChem CID 114026323) has the molecular formula C13H6Br2ClF2I and a molecular weight of 522.35 g/mol. Its IUPAC name is 1-[bromo-(2-bromo-5-iodophenyl)methyl]-2-chloro-4,5-difluorobenzene.
| Compound Name | 1-[bromo-(2-bromo-5-iodophenyl)methyl]-2-chloro-4,5-difluorobenzene |
|---|---|
| PubChem CID | 114026323 |
| Molecular Formula | C13H6Br2ClF2I |
| Molecular Weight | 522.35 g/mol |
| Exact Mass | 519.75 |
| IUPAC Name | 1-[bromo-(2-bromo-5-iodophenyl)methyl]-2-chloro-4,5-difluorobenzene |
| SMILES | Fc1cc(Cl)c(C(Br)c2cc(I)ccc2Br)cc1F |
| InChI | InChI=1S/C13H6Br2ClF2I/c14-9-2-1-6(19)3-7(9)13(15)8-4-11(17)12(18)5-10(8)16/h1-5,13H |
| InChIKey | INIUEYDLPJGBCL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.35 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|