C14H10Br3F — CID 114020716
2,4-dibromo-1-[1-bromo-2-(4-fluorophenyl)ethyl]benzene (PubChem CID 114020716) has the molecular formula C14H10Br3F and a molecular weight of 436.94 g/mol. Its IUPAC name is 2,4-dibromo-1-[1-bromo-2-(4-fluorophenyl)ethyl]benzene.
| Compound Name | 2,4-dibromo-1-[1-bromo-2-(4-fluorophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 114020716 |
| Molecular Formula | C14H10Br3F |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 433.83 |
| IUPAC Name | 2,4-dibromo-1-[1-bromo-2-(4-fluorophenyl)ethyl]benzene |
| SMILES | Fc1ccc(CC(Br)c2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C14H10Br3F/c15-10-3-6-12(14(17)8-10)13(16)7-9-1-4-11(18)5-2-9/h1-6,8,13H,7H2 |
| InChIKey | PWSGKWUDMPOHRR-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|