C12H14BrF3 — CID 115483023
4-(1-bromo-2,2,2-trifluoroethyl)-1,2-diethylbenzene (PubChem CID 115483023) has the molecular formula C12H14BrF3 and a molecular weight of 295.14 g/mol. Its IUPAC name is 4-(1-bromo-2,2,2-trifluoroethyl)-1,2-diethylbenzene.
| Compound Name | 4-(1-bromo-2,2,2-trifluoroethyl)-1,2-diethylbenzene |
|---|---|
| PubChem CID | 115483023 |
| Molecular Formula | C12H14BrF3 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 4-(1-bromo-2,2,2-trifluoroethyl)-1,2-diethylbenzene |
| SMILES | CCc1ccc(C(Br)C(F)(F)F)cc1CC |
| InChI | InChI=1S/C12H14BrF3/c1-3-8-5-6-10(7-9(8)4-2)11(13)12(14,15)16/h5-7,11H,3-4H2,1-2H3 |
| InChIKey | MDKUUOJHRSLCGP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|