C9H7BrF4 — CID 124512118
4-[(1R)-1-bromo-2,2,2-trifluoroethyl]-1-fluoro-2-methylbenzene (PubChem CID 124512118) has the molecular formula C9H7BrF4 and a molecular weight of 271.05 g/mol. Its IUPAC name is 4-[(1R)-1-bromo-2,2,2-trifluoroethyl]-1-fluoro-2-methylbenzene.
| Compound Name | 4-[(1R)-1-bromo-2,2,2-trifluoroethyl]-1-fluoro-2-methylbenzene |
|---|---|
| PubChem CID | 124512118 |
| Molecular Formula | C9H7BrF4 |
| Molecular Weight | 271.05 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | 4-[(1R)-1-bromo-2,2,2-trifluoroethyl]-1-fluoro-2-methylbenzene |
| SMILES | Cc1cc([C@@H](Br)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C9H7BrF4/c1-5-4-6(2-3-7(5)11)8(10)9(12,13)14/h2-4,8H,1H3/t8-/m1/s1 |
| InChIKey | HTQDVOAFGIEPDI-MRVPVSSYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.05 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|