C9H4BrF4N — CID 129391933
5-[(1S)-1-bromo-2,2,2-trifluoroethyl]-2-fluorobenzonitrile (PubChem CID 129391933) has the molecular formula C9H4BrF4N and a molecular weight of 282.03 g/mol. Its IUPAC name is 5-[(1S)-1-bromo-2,2,2-trifluoroethyl]-2-fluorobenzonitrile.
| Compound Name | 5-[(1S)-1-bromo-2,2,2-trifluoroethyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 129391933 |
| Molecular Formula | C9H4BrF4N |
| Molecular Weight | 282.03 g/mol |
| Exact Mass | 280.95 |
| IUPAC Name | 5-[(1S)-1-bromo-2,2,2-trifluoroethyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc([C@H](Br)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C9H4BrF4N/c10-8(9(12,13)14)5-1-2-7(11)6(3-5)4-15/h1-3,8H/t8-/m0/s1 |
| InChIKey | BRRDLWFAHDUFIP-QMMMGPOBSA-N |
| XLogP | 3.70 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.03 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|