C12H16ClFN2 — CID 171230575
5-[(1S)-1-amino-3-methylbutyl]-2-fluorobenzonitrile;hydrochloride (PubChem CID 171230575) has the molecular formula C12H16ClFN2 and a molecular weight of 242.72 g/mol. Its IUPAC name is 5-[(1S)-1-amino-3-methylbutyl]-2-fluorobenzonitrile;hydrochloride.
| Compound Name | 5-[(1S)-1-amino-3-methylbutyl]-2-fluorobenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 171230575 |
| Molecular Formula | C12H16ClFN2 |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 5-[(1S)-1-amino-3-methylbutyl]-2-fluorobenzonitrile;hydrochloride |
| SMILES | CC(C)C[C@H](N)c1ccc(F)c(C#N)c1.Cl |
| InChI | InChI=1S/C12H15FN2.ClH/c1-8(2)5-12(15)9-3-4-11(13)10(6-9)7-14;/h3-4,6,8,12H,5,15H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | KZPHZXLZDIPJSA-YDALLXLXSA-N |
| XLogP | 3.17 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |