C13H18ClFN2 — CID 171210993
5-[(1R)-1-amino-4-methylpentyl]-2-fluorobenzonitrile;hydrochloride (PubChem CID 171210993) has the molecular formula C13H18ClFN2 and a molecular weight of 256.75 g/mol. Its IUPAC name is 5-[(1R)-1-amino-4-methylpentyl]-2-fluorobenzonitrile;hydrochloride.
| Compound Name | 5-[(1R)-1-amino-4-methylpentyl]-2-fluorobenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 171210993 |
| Molecular Formula | C13H18ClFN2 |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 5-[(1R)-1-amino-4-methylpentyl]-2-fluorobenzonitrile;hydrochloride |
| SMILES | CC(C)CC[C@@H](N)c1ccc(F)c(C#N)c1.Cl |
| InChI | InChI=1S/C13H17FN2.ClH/c1-9(2)3-6-13(16)10-4-5-12(14)11(7-10)8-15;/h4-5,7,9,13H,3,6,16H2,1-2H3;1H/t13-;/m1./s1 |
| InChIKey | DSMAVXAVBGASRN-BTQNPOSSSA-N |
| XLogP | 3.56 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |