C11H14ClFN2O — CID 171211000
5-[(1R)-1-amino-4-hydroxybutyl]-2-fluorobenzonitrile;hydrochloride (PubChem CID 171211000) has the molecular formula C11H14ClFN2O and a molecular weight of 244.70 g/mol. Its IUPAC name is 5-[(1R)-1-amino-4-hydroxybutyl]-2-fluorobenzonitrile;hydrochloride.
| Compound Name | 5-[(1R)-1-amino-4-hydroxybutyl]-2-fluorobenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 171211000 |
| Molecular Formula | C11H14ClFN2O |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-[(1R)-1-amino-4-hydroxybutyl]-2-fluorobenzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cc([C@H](N)CCCO)ccc1F |
| InChI | InChI=1S/C11H13FN2O.ClH/c12-10-4-3-8(6-9(10)7-13)11(14)2-1-5-15;/h3-4,6,11,15H,1-2,5,14H2;1H/t11-;/m1./s1 |
| InChIKey | BTYNYEGZIRITRD-RFVHGSKJSA-N |
| XLogP | 1.89 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |