C11H10F4N2 — CID 171210977
5-[(1R)-1-amino-4,4,4-trifluorobutyl]-2-fluorobenzonitrile (PubChem CID 171210977) has the molecular formula C11H10F4N2 and a molecular weight of 246.21 g/mol. Its IUPAC name is 5-[(1R)-1-amino-4,4,4-trifluorobutyl]-2-fluorobenzonitrile.
| Compound Name | 5-[(1R)-1-amino-4,4,4-trifluorobutyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 171210977 |
| Molecular Formula | C11H10F4N2 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 5-[(1R)-1-amino-4,4,4-trifluorobutyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc([C@H](N)CCC(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H10F4N2/c12-9-2-1-7(5-8(9)6-16)10(17)3-4-11(13,14)15/h1-2,5,10H,3-4,17H2/t10-/m1/s1 |
| InChIKey | FIGAENGANIRNEX-SNVBAGLBSA-N |
| XLogP | 3.04 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |