C9H4BrF4N — CID 123679784
4-(1-bromo-2,2,2-trifluoroethyl)-1-fluoro-2-isocyanobenzene (PubChem CID 123679784) has the molecular formula C9H4BrF4N and a molecular weight of 282.03 g/mol. Its IUPAC name is 4-(1-bromo-2,2,2-trifluoroethyl)-1-fluoro-2-isocyanobenzene.
| Compound Name | 4-(1-bromo-2,2,2-trifluoroethyl)-1-fluoro-2-isocyanobenzene |
|---|---|
| PubChem CID | 123679784 |
| Molecular Formula | C9H4BrF4N |
| Molecular Weight | 282.03 g/mol |
| Exact Mass | 280.95 |
| IUPAC Name | 4-(1-bromo-2,2,2-trifluoroethyl)-1-fluoro-2-isocyanobenzene |
| SMILES | [C-]#[N+]c1cc(C(Br)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C9H4BrF4N/c1-15-7-4-5(2-3-6(7)11)8(10)9(12,13)14/h2-4,8H |
| InChIKey | CLPIVMXVMCKZGB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.03 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|