C8H5BrF4 — CID 94794891
1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene (PubChem CID 94794891) has the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. Its IUPAC name is 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene.
| Compound Name | 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 94794891 |
| Molecular Formula | C8H5BrF4 |
| Molecular Weight | 257.02 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene |
| SMILES | Fc1ccc([C@@H](Br)C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H5BrF4/c9-7(8(11,12)13)5-1-3-6(10)4-2-5/h1-4,7H/t7-/m1/s1 |
| InChIKey | DQCQFCZGHRBWOB-SSDOTTSWSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.02 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|