About 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene
1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene (PubChem CID 94794891) has the molecular formula C8H5BrF4
and a molecular weight of 257.02 g/mol. Its IUPAC name is 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene.
Molecular Properties
| Compound Name | 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene |
| PubChem CID | 94794891 |
| Molecular Formula | C8H5BrF4 |
| Molecular Weight | 257.02 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene |
| SMILES | Fc1ccc([C@@H](Br)C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H5BrF4/c9-7(8(11,12)13)5-1-3-6(10)4-2-5/h1-4,7H/t7-/m1/s1 |
| InChIKey | DQCQFCZGHRBWOB-SSDOTTSWSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.02 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene?
The IUPAC name of 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene (CID 94794891) is 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene.
What is the SMILES notation for 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene?
The canonical SMILES for 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene is Fc1ccc([C@@H](Br)C(F)(F)F)cc1.
What is the InChIKey of 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene?
The InChIKey is DQCQFCZGHRBWOB-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H5BrF4/c9-7(8(11,12)13)5-1-3-6(10)4-2-5/h1-4,7H/t7-/m1/s1.
What are the key properties of 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene?
1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene has a molecular weight of 257.02 g/mol, XLogP of 3.82, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-1-bromo-2,2,2-trifluoroethyl]-4-fluorobenzene is sourced from PubChem (CID 94794891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).