C10H9BrFNO2 — CID 171859989
5-(3-bromo-1,2-dihydroxypropyl)-2-fluorobenzonitrile (PubChem CID 171859989) has the molecular formula C10H9BrFNO2 and a molecular weight of 274.09 g/mol. Its IUPAC name is 5-(3-bromo-1,2-dihydroxypropyl)-2-fluorobenzonitrile.
| Compound Name | 5-(3-bromo-1,2-dihydroxypropyl)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 171859989 |
| Molecular Formula | C10H9BrFNO2 |
| Molecular Weight | 274.09 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 5-(3-bromo-1,2-dihydroxypropyl)-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(C(O)C(O)CBr)ccc1F |
| InChI | InChI=1S/C10H9BrFNO2/c11-4-9(14)10(15)6-1-2-8(12)7(3-6)5-13/h1-3,9-10,14-15H,4H2 |
| InChIKey | SPSBVJPOLNGAID-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.09 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|