C15H17BrS — CID 79808976
3-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-4-methylthiophene (PubChem CID 79808976) has the molecular formula C15H17BrS and a molecular weight of 309.27 g/mol. Its IUPAC name is 3-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-4-methylthiophene.
| Compound Name | 3-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-4-methylthiophene |
|---|---|
| PubChem CID | 79808976 |
| Molecular Formula | C15H17BrS |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 3-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-4-methylthiophene |
| SMILES | Cc1ccc(CC(Br)c2cscc2C)cc1C |
| InChI | InChI=1S/C15H17BrS/c1-10-4-5-13(6-11(10)2)7-15(16)14-9-17-8-12(14)3/h4-6,8-9,15H,7H2,1-3H3 |
| InChIKey | NJJKFWKVHBUNFU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|