C16H15Br2FO2 — CID 63544125
4-bromo-2-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]-1-fluorobenzene (PubChem CID 63544125) has the molecular formula C16H15Br2FO2 and a molecular weight of 418.10 g/mol. Its IUPAC name is 4-bromo-2-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]-1-fluorobenzene.
| Compound Name | 4-bromo-2-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]-1-fluorobenzene |
|---|---|
| PubChem CID | 63544125 |
| Molecular Formula | C16H15Br2FO2 |
| Molecular Weight | 418.10 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | 4-bromo-2-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]-1-fluorobenzene |
| SMILES | COc1ccc(CC(Br)c2cc(Br)ccc2F)cc1OC |
| InChI | InChI=1S/C16H15Br2FO2/c1-20-15-6-3-10(8-16(15)21-2)7-13(18)12-9-11(17)4-5-14(12)19/h3-6,8-9,13H,7H2,1-2H3 |
| InChIKey | CDZXPJMELZVGSN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.10 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|