C12H15BrF2O2 — CID 166440390
4-(2-bromo-4,4-difluorobutyl)-1,2-dimethoxybenzene (PubChem CID 166440390) has the molecular formula C12H15BrF2O2 and a molecular weight of 309.15 g/mol. Its IUPAC name is 4-(2-bromo-4,4-difluorobutyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(2-bromo-4,4-difluorobutyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 166440390 |
| Molecular Formula | C12H15BrF2O2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 4-(2-bromo-4,4-difluorobutyl)-1,2-dimethoxybenzene |
| SMILES | COc1ccc(CC(Br)CC(F)F)cc1OC |
| InChI | InChI=1S/C12H15BrF2O2/c1-16-10-4-3-8(6-11(10)17-2)5-9(13)7-12(14)15/h3-4,6,9,12H,5,7H2,1-2H3 |
| InChIKey | BMKVRAHHPYSXPW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|