C14H21BrO2 — CID 55148976
4-(2-bromo-4-methylpentyl)-1,2-dimethoxybenzene (PubChem CID 55148976) has the molecular formula C14H21BrO2 and a molecular weight of 301.22 g/mol. Its IUPAC name is 4-(2-bromo-4-methylpentyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(2-bromo-4-methylpentyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 55148976 |
| Molecular Formula | C14H21BrO2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-(2-bromo-4-methylpentyl)-1,2-dimethoxybenzene |
| SMILES | COc1ccc(CC(Br)CC(C)C)cc1OC |
| InChI | InChI=1S/C14H21BrO2/c1-10(2)7-12(15)8-11-5-6-13(16-3)14(9-11)17-4/h5-6,9-10,12H,7-8H2,1-4H3 |
| InChIKey | VPKHNIVIAVZWTA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|