C17H27BrO2 — CID 63834565
4-(2-bromo-4,5,5-trimethylhexyl)-1,2-dimethoxybenzene (PubChem CID 63834565) has the molecular formula C17H27BrO2 and a molecular weight of 343.31 g/mol. Its IUPAC name is 4-(2-bromo-4,5,5-trimethylhexyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(2-bromo-4,5,5-trimethylhexyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 63834565 |
| Molecular Formula | C17H27BrO2 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-(2-bromo-4,5,5-trimethylhexyl)-1,2-dimethoxybenzene |
| SMILES | COc1ccc(CC(Br)CC(C)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C17H27BrO2/c1-12(17(2,3)4)9-14(18)10-13-7-8-15(19-5)16(11-13)20-6/h7-8,11-12,14H,9-10H2,1-6H3 |
| InChIKey | IHXKYZKQLWIIHZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|