C18H31NO2 — CID 63834170
1-(3,4-dimethoxyphenyl)-N,4,5,5-tetramethylhexan-2-amine (PubChem CID 63834170) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N,4,5,5-tetramethylhexan-2-amine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N,4,5,5-tetramethylhexan-2-amine |
|---|---|
| PubChem CID | 63834170 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N,4,5,5-tetramethylhexan-2-amine |
| SMILES | CNC(Cc1ccc(OC)c(OC)c1)CC(C)C(C)(C)C |
| InChI | InChI=1S/C18H31NO2/c1-13(18(2,3)4)10-15(19-5)11-14-8-9-16(20-6)17(12-14)21-7/h8-9,12-13,15,19H,10-11H2,1-7H3 |
| InChIKey | ZCUOLNDFNJMNHN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |