C17H16FNO2 — CID 82140609
3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)propanenitrile (PubChem CID 82140609) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)propanenitrile.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)propanenitrile |
|---|---|
| PubChem CID | 82140609 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)propanenitrile |
| SMILES | COc1ccc(CC(C#N)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C17H16FNO2/c1-20-16-8-7-12(10-17(16)21-2)9-13(11-19)14-5-3-4-6-15(14)18/h3-8,10,13H,9H2,1-2H3 |
| InChIKey | VAXVXKZTTZRIBY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |