C15H10Cl2FN — CID 82140040
3-(3,4-dichlorophenyl)-2-(2-fluorophenyl)propanenitrile (PubChem CID 82140040) has the molecular formula C15H10Cl2FN and a molecular weight of 294.16 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-2-(2-fluorophenyl)propanenitrile.
| Compound Name | 3-(3,4-dichlorophenyl)-2-(2-fluorophenyl)propanenitrile |
|---|---|
| PubChem CID | 82140040 |
| Molecular Formula | C15H10Cl2FN |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-2-(2-fluorophenyl)propanenitrile |
| SMILES | N#CC(Cc1ccc(Cl)c(Cl)c1)c1ccccc1F |
| InChI | InChI=1S/C15H10Cl2FN/c16-13-6-5-10(8-14(13)17)7-11(9-19)12-3-1-2-4-15(12)18/h1-6,8,11H,7H2 |
| InChIKey | ZHHGCZFIDWPPEP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |