C18H19NO3 — CID 42627879
3-(3,4-dimethoxyphenyl)-2-phenylmethoxypropanenitrile (PubChem CID 42627879) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-phenylmethoxypropanenitrile.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-phenylmethoxypropanenitrile |
|---|---|
| PubChem CID | 42627879 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-phenylmethoxypropanenitrile |
| SMILES | COc1ccc(CC(C#N)OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C18H19NO3/c1-20-17-9-8-15(11-18(17)21-2)10-16(12-19)22-13-14-6-4-3-5-7-14/h3-9,11,16H,10,13H2,1-2H3 |
| InChIKey | VADMRQMRLFCFKW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |