C19H22O5 — CID 102280841
1,2-dimethoxy-4-(1-phenylmethoxyprop-2-enylperoxymethyl)benzene (PubChem CID 102280841) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1,2-dimethoxy-4-(1-phenylmethoxyprop-2-enylperoxymethyl)benzene.
| Compound Name | 1,2-dimethoxy-4-(1-phenylmethoxyprop-2-enylperoxymethyl)benzene |
|---|---|
| PubChem CID | 102280841 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1,2-dimethoxy-4-(1-phenylmethoxyprop-2-enylperoxymethyl)benzene |
| SMILES | C=CC(OCc1ccccc1)OOCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H22O5/c1-4-19(22-13-15-8-6-5-7-9-15)24-23-14-16-10-11-17(20-2)18(12-16)21-3/h4-12,19H,1,13-14H2,2-3H3 |
| InChIKey | XTECWVZRKOXARO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|