C11H14O3 — CID 86205120
4-(ethenoxymethyl)-1,2-dimethoxybenzene (PubChem CID 86205120) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-(ethenoxymethyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(ethenoxymethyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 86205120 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 4-(ethenoxymethyl)-1,2-dimethoxybenzene |
| SMILES | C=COCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C11H14O3/c1-4-14-8-9-5-6-10(12-2)11(7-9)13-3/h4-7H,1,8H2,2-3H3 |
| InChIKey | WEQPZVIZQNIYQZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|