C10H14O4 — CID 69007274
(3,4-dimethoxyphenyl)methoxymethanol (PubChem CID 69007274) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methoxymethanol.
| Compound Name | (3,4-dimethoxyphenyl)methoxymethanol |
|---|---|
| PubChem CID | 69007274 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (3,4-dimethoxyphenyl)methoxymethanol |
| SMILES | COc1ccc(COCO)cc1OC |
| InChI | InChI=1S/C10H14O4/c1-12-9-4-3-8(6-14-7-11)5-10(9)13-2/h3-5,11H,6-7H2,1-2H3 |
| InChIKey | VZEWXFOSYBAPPA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|