C24H30O10 — CID 171933870
dimethyl (2R,3R)-2,3-bis[(3,4-dimethoxyphenyl)methoxy]butanedioate (PubChem CID 171933870) has the molecular formula C24H30O10 and a molecular weight of 478.49 g/mol. Its IUPAC name is dimethyl (2R,3R)-2,3-bis[(3,4-dimethoxyphenyl)methoxy]butanedioate.
| Compound Name | dimethyl (2R,3R)-2,3-bis[(3,4-dimethoxyphenyl)methoxy]butanedioate |
|---|---|
| PubChem CID | 171933870 |
| Molecular Formula | C24H30O10 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | dimethyl (2R,3R)-2,3-bis[(3,4-dimethoxyphenyl)methoxy]butanedioate |
| SMILES | COC(=O)[C@H](OCc1ccc(OC)c(OC)c1)[C@@H](OCc1ccc(OC)c(OC)c1)C(=O)OC |
| InChI | InChI=1S/C24H30O10/c1-27-17-9-7-15(11-19(17)29-3)13-33-21(23(25)31-5)22(24(26)32-6)34-14-16-8-10-18(28-2)20(12-16)30-4/h7-12,21-22H,13-14H2,1-6H3/t21-,22-/m1/s1 |
| InChIKey | ADKCCPZSQUMTAO-FGZHOGPDSA-N |
| XLogP | 2.54 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |