C13H17NO5 — CID 54372305
methyl 4-(3,4-dimethoxyphenyl)-2-nitrosobutanoate (PubChem CID 54372305) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is methyl 4-(3,4-dimethoxyphenyl)-2-nitrosobutanoate.
| Compound Name | methyl 4-(3,4-dimethoxyphenyl)-2-nitrosobutanoate |
|---|---|
| PubChem CID | 54372305 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | methyl 4-(3,4-dimethoxyphenyl)-2-nitrosobutanoate |
| SMILES | COC(=O)C(CCc1ccc(OC)c(OC)c1)N=O |
| InChI | InChI=1S/C13H17NO5/c1-17-11-7-5-9(8-12(11)18-2)4-6-10(14-16)13(15)19-3/h5,7-8,10H,4,6H2,1-3H3 |
| InChIKey | UUAZNVQYXOUEIA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |