C22H26O10 — CID 171933866
dimethyl (2R,3R)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methoxy]butanedioate (PubChem CID 171933866) has the molecular formula C22H26O10 and a molecular weight of 450.44 g/mol. Its IUPAC name is dimethyl (2R,3R)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methoxy]butanedioate.
| Compound Name | dimethyl (2R,3R)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methoxy]butanedioate |
|---|---|
| PubChem CID | 171933866 |
| Molecular Formula | C22H26O10 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | dimethyl (2R,3R)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methoxy]butanedioate |
| SMILES | COC(=O)[C@H](OCc1ccc(O)c(OC)c1)[C@@H](OCc1ccc(O)c(OC)c1)C(=O)OC |
| InChI | InChI=1S/C22H26O10/c1-27-17-9-13(5-7-15(17)23)11-31-19(21(25)29-3)20(22(26)30-4)32-12-14-6-8-16(24)18(10-14)28-2/h5-10,19-20,23-24H,11-12H2,1-4H3/t19-,20-/m1/s1 |
| InChIKey | ZFCZVSLDJAYOQG-WOJBJXKFSA-N |
| XLogP | 1.93 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |