C20H24O6 — CID 135228474
methyl 4-(4-hydroxy-3-methoxyphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methyl]butanoate (PubChem CID 135228474) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is methyl 4-(4-hydroxy-3-methoxyphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methyl]butanoate.
| Compound Name | methyl 4-(4-hydroxy-3-methoxyphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methyl]butanoate |
|---|---|
| PubChem CID | 135228474 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | methyl 4-(4-hydroxy-3-methoxyphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methyl]butanoate |
| SMILES | COC(=O)C(CCc1ccc(O)c(OC)c1)Cc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C20H24O6/c1-24-18-11-13(5-8-16(18)21)4-7-15(20(23)26-3)10-14-6-9-17(22)19(12-14)25-2/h5-6,8-9,11-12,15,21-22H,4,7,10H2,1-3H3 |
| InChIKey | GJTAQTAUBHWEMU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |