C22H28O8 — CID 144758132
methyl formate;methyl 4-(4-hydroxy-3-methoxyphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methyl]butanoate (PubChem CID 144758132) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is methyl formate;methyl 4-(4-hydroxy-3-methoxyphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methyl]butanoate.
| Compound Name | methyl formate;methyl 4-(4-hydroxy-3-methoxyphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methyl]butanoate |
|---|---|
| PubChem CID | 144758132 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | methyl formate;methyl 4-(4-hydroxy-3-methoxyphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methyl]butanoate |
| SMILES | COC(=O)C(CCc1ccc(O)c(OC)c1)Cc1ccc(O)c(OC)c1.COC=O |
| InChI | InChI=1S/C20H24O6.C2H4O2/c1-24-18-11-13(5-8-16(18)21)4-7-15(20(23)26-3)10-14-6-9-17(22)19(12-14)25-2;1-4-2-3/h5-6,8-9,11-12,15,21-22H,4,7,10H2,1-3H3;2H,1H3 |
| InChIKey | UYACRSSDYNIGNU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|