C11H16O5 — CID 167081635
(3,4,5-trimethoxyphenyl)methoxymethanol (PubChem CID 167081635) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl)methoxymethanol.
| Compound Name | (3,4,5-trimethoxyphenyl)methoxymethanol |
|---|---|
| PubChem CID | 167081635 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (3,4,5-trimethoxyphenyl)methoxymethanol |
| SMILES | COc1cc(COCO)cc(OC)c1OC |
| InChI | InChI=1S/C11H16O5/c1-13-9-4-8(6-16-7-12)5-10(14-2)11(9)15-3/h4-5,12H,6-7H2,1-3H3 |
| InChIKey | UQVJHFWJBZOWAT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|