C16H26O4 — CID 54336542
5-(hexoxymethyl)-1,2,3-trimethoxybenzene (PubChem CID 54336542) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 5-(hexoxymethyl)-1,2,3-trimethoxybenzene.
| Compound Name | 5-(hexoxymethyl)-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 54336542 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 5-(hexoxymethyl)-1,2,3-trimethoxybenzene |
| SMILES | CCCCCCOCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H26O4/c1-5-6-7-8-9-20-12-13-10-14(17-2)16(19-4)15(11-13)18-3/h10-11H,5-9,12H2,1-4H3 |
| InChIKey | FEVSMYZPSNQCJE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|