C16H26N2O3 — CID 106790332
4-(heptoxymethyl)-N'-hydroxy-2-methoxybenzenecarboximidamide (PubChem CID 106790332) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 4-(heptoxymethyl)-N'-hydroxy-2-methoxybenzenecarboximidamide.
| Compound Name | 4-(heptoxymethyl)-N'-hydroxy-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 106790332 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 4-(heptoxymethyl)-N'-hydroxy-2-methoxybenzenecarboximidamide |
| SMILES | CCCCCCCOCc1ccc(/C(N)=N/O)c(OC)c1 |
| InChI | InChI=1S/C16H26N2O3/c1-3-4-5-6-7-10-21-12-13-8-9-14(16(17)18-19)15(11-13)20-2/h8-9,11,19H,3-7,10,12H2,1-2H3,(H2,17,18) |
| InChIKey | YKEHGGNRGJBXGR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|