C13H20N2O4 — CID 106790372
N'-hydroxy-2-methoxy-4-(3-methoxypropoxymethyl)benzenecarboximidamide (PubChem CID 106790372) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N'-hydroxy-2-methoxy-4-(3-methoxypropoxymethyl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-2-methoxy-4-(3-methoxypropoxymethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 106790372 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N'-hydroxy-2-methoxy-4-(3-methoxypropoxymethyl)benzenecarboximidamide |
| SMILES | COCCCOCc1ccc(/C(N)=N/O)c(OC)c1 |
| InChI | InChI=1S/C13H20N2O4/c1-17-6-3-7-19-9-10-4-5-11(13(14)15-16)12(8-10)18-2/h4-5,8,16H,3,6-7,9H2,1-2H3,(H2,14,15) |
| InChIKey | HMAXQNMOKIDIGH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|