C13H16F3NO2S — CID 106789207
2-methoxy-4-(4,4,4-trifluorobutoxymethyl)benzenecarbothioamide (PubChem CID 106789207) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is 2-methoxy-4-(4,4,4-trifluorobutoxymethyl)benzenecarbothioamide.
| Compound Name | 2-methoxy-4-(4,4,4-trifluorobutoxymethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 106789207 |
| Molecular Formula | C13H16F3NO2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-methoxy-4-(4,4,4-trifluorobutoxymethyl)benzenecarbothioamide |
| SMILES | COc1cc(COCCCC(F)(F)F)ccc1C(N)=S |
| InChI | InChI=1S/C13H16F3NO2S/c1-18-11-7-9(3-4-10(11)12(17)20)8-19-6-2-5-13(14,15)16/h3-4,7H,2,5-6,8H2,1H3,(H2,17,20) |
| InChIKey | IRTGHMPYAULDRV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|