C12H13F4NOS — CID 82788247
5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzenecarbothioamide (PubChem CID 82788247) has the molecular formula C12H13F4NOS and a molecular weight of 295.30 g/mol. Its IUPAC name is 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzenecarbothioamide.
| Compound Name | 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 82788247 |
| Molecular Formula | C12H13F4NOS |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)ccc1COCCCC(F)(F)F |
| InChI | InChI=1S/C12H13F4NOS/c13-9-3-2-8(10(6-9)11(17)19)7-18-5-1-4-12(14,15)16/h2-3,6H,1,4-5,7H2,(H2,17,19) |
| InChIKey | XCUSLSYUTPLXKV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|