C11H11F4NOS — CID 66276106
5-fluoro-2-(1,1,1-trifluoropropan-2-yloxymethyl)benzenecarbothioamide (PubChem CID 66276106) has the molecular formula C11H11F4NOS and a molecular weight of 281.27 g/mol. Its IUPAC name is 5-fluoro-2-(1,1,1-trifluoropropan-2-yloxymethyl)benzenecarbothioamide.
| Compound Name | 5-fluoro-2-(1,1,1-trifluoropropan-2-yloxymethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 66276106 |
| Molecular Formula | C11H11F4NOS |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 5-fluoro-2-(1,1,1-trifluoropropan-2-yloxymethyl)benzenecarbothioamide |
| SMILES | CC(OCc1ccc(F)cc1C(N)=S)C(F)(F)F |
| InChI | InChI=1S/C11H11F4NOS/c1-6(11(13,14)15)17-5-7-2-3-8(12)4-9(7)10(16)18/h2-4,6H,5H2,1H3,(H2,16,18) |
| InChIKey | WXAAGFMSDQGENE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|