C14H14F4O3 — CID 82782588
(E)-3-[5-fluoro-2-(4,4,4-trifluorobutoxymethyl)phenyl]prop-2-enoic acid (PubChem CID 82782588) has the molecular formula C14H14F4O3 and a molecular weight of 306.25 g/mol. Its IUPAC name is (E)-3-[5-fluoro-2-(4,4,4-trifluorobutoxymethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-fluoro-2-(4,4,4-trifluorobutoxymethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82782588 |
| Molecular Formula | C14H14F4O3 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (E)-3-[5-fluoro-2-(4,4,4-trifluorobutoxymethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(F)ccc1COCCCC(F)(F)F |
| InChI | InChI=1S/C14H14F4O3/c15-12-4-2-11(10(8-12)3-5-13(19)20)9-21-7-1-6-14(16,17)18/h2-5,8H,1,6-7,9H2,(H,19,20)/b5-3+ |
| InChIKey | AQRAOCFYMBGLDK-HWKANZROSA-N |
| XLogP | 3.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|