C15H19FO4 — CID 103489623
(E)-3-[2-(1-ethoxypropan-2-yloxymethyl)-5-fluorophenyl]prop-2-enoic acid (PubChem CID 103489623) has the molecular formula C15H19FO4 and a molecular weight of 282.31 g/mol. Its IUPAC name is (E)-3-[2-(1-ethoxypropan-2-yloxymethyl)-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(1-ethoxypropan-2-yloxymethyl)-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103489623 |
| Molecular Formula | C15H19FO4 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (E)-3-[2-(1-ethoxypropan-2-yloxymethyl)-5-fluorophenyl]prop-2-enoic acid |
| SMILES | CCOCC(C)OCc1ccc(F)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C15H19FO4/c1-3-19-9-11(2)20-10-13-4-6-14(16)8-12(13)5-7-15(17)18/h4-8,11H,3,9-10H2,1-2H3,(H,17,18)/b7-5+ |
| InChIKey | SWBHLKOCWBTPIK-FNORWQNLSA-N |
| XLogP | 2.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|