C14H15FO3 — CID 94233140
(E)-3-[2-(cyclopropylmethoxymethyl)-5-fluorophenyl]prop-2-enoic acid (PubChem CID 94233140) has the molecular formula C14H15FO3 and a molecular weight of 250.27 g/mol. Its IUPAC name is (E)-3-[2-(cyclopropylmethoxymethyl)-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(cyclopropylmethoxymethyl)-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 94233140 |
| Molecular Formula | C14H15FO3 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (E)-3-[2-(cyclopropylmethoxymethyl)-5-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(F)ccc1COCC1CC1 |
| InChI | InChI=1S/C14H15FO3/c15-13-5-3-12(9-18-8-10-1-2-10)11(7-13)4-6-14(16)17/h3-7,10H,1-2,8-9H2,(H,16,17)/b6-4+ |
| InChIKey | CARQCFHRCYUCQH-GQCTYLIASA-N |
| XLogP | 2.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|