C17H21FO3 — CID 76942593
3-[5-(cyclohexylmethoxymethyl)-2-fluorophenyl]prop-2-enoic acid (PubChem CID 76942593) has the molecular formula C17H21FO3 and a molecular weight of 292.35 g/mol. Its IUPAC name is 3-[5-(cyclohexylmethoxymethyl)-2-fluorophenyl]prop-2-enoic acid.
| Compound Name | 3-[5-(cyclohexylmethoxymethyl)-2-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76942593 |
| Molecular Formula | C17H21FO3 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-[5-(cyclohexylmethoxymethyl)-2-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(COCC2CCCCC2)ccc1F |
| InChI | InChI=1S/C17H21FO3/c18-16-8-6-14(10-15(16)7-9-17(19)20)12-21-11-13-4-2-1-3-5-13/h6-10,13H,1-5,11-12H2,(H,19,20) |
| InChIKey | QNQMHOZLDORBHT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|