C17H21FO2 — CID 62383927
3-[5-(cyclohexylmethoxymethyl)-2-fluorophenyl]prop-2-yn-1-ol (PubChem CID 62383927) has the molecular formula C17H21FO2 and a molecular weight of 276.35 g/mol. Its IUPAC name is 3-[5-(cyclohexylmethoxymethyl)-2-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[5-(cyclohexylmethoxymethyl)-2-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 62383927 |
| Molecular Formula | C17H21FO2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 3-[5-(cyclohexylmethoxymethyl)-2-fluorophenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1cc(COCC2CCCCC2)ccc1F |
| InChI | InChI=1S/C17H21FO2/c18-17-9-8-15(11-16(17)7-4-10-19)13-20-12-14-5-2-1-3-6-14/h8-9,11,14,19H,1-3,5-6,10,12-13H2 |
| InChIKey | HVBPLXVVGCNDCN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|